C26H28O11 — CID 25124148
[(2R,3S,4R,5R,6R)-4-acetyloxy-6-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]methyl]-5-hydroxy-2-methyloxan-3-yl] acetate (PubChem CID 25124148) has the molecular formula C26H28O11 and a molecular weight of 516.50 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4-acetyloxy-6-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]methyl]-5-hydroxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-4-acetyloxy-6-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]methyl]-5-hydroxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 25124148 |
| Molecular Formula | C26H28O11 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4-acetyloxy-6-[[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydrochromen-3-yl]methyl]-5-hydroxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](O)[C@@H](CC2C(=O)c3c(O)cc(O)cc3OC2c2ccc(O)cc2)O[C@H](C)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H28O11/c1-11-24(35-12(2)27)26(36-13(3)28)23(33)20(34-11)10-17-22(32)21-18(31)8-16(30)9-19(21)37-25(17)14-4-6-15(29)7-5-14/h4-9,11,17,20,23-26,29-31,33H,10H2,1-3H3/t11-,17?,20-,23-,24+,25?,26-/m1/s1 |
| InChIKey | SLSJSQVGWJJVOB-URUPGVJMSA-N |
| XLogP | 2.14 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |