C17H30N2O2 — CID 25128805
4-(3-methylbutyl)-2,6-bis(2-methylpropoxy)pyrimidine (PubChem CID 25128805) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 4-(3-methylbutyl)-2,6-bis(2-methylpropoxy)pyrimidine.
| Compound Name | 4-(3-methylbutyl)-2,6-bis(2-methylpropoxy)pyrimidine |
|---|---|
| PubChem CID | 25128805 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 4-(3-methylbutyl)-2,6-bis(2-methylpropoxy)pyrimidine |
| SMILES | CC(C)CCc1cc(OCC(C)C)nc(OCC(C)C)n1 |
| InChI | InChI=1S/C17H30N2O2/c1-12(2)7-8-15-9-16(20-10-13(3)4)19-17(18-15)21-11-14(5)6/h9,12-14H,7-8,10-11H2,1-6H3 |
| InChIKey | JRRYFXZBVRBKOV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |