C8H10F2N2O — CID 89084421
4-(2,2-difluoroethoxy)-6-ethylpyrimidine (PubChem CID 89084421) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-6-ethylpyrimidine.
| Compound Name | 4-(2,2-difluoroethoxy)-6-ethylpyrimidine |
|---|---|
| PubChem CID | 89084421 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-6-ethylpyrimidine |
| SMILES | CCc1cc(OCC(F)F)ncn1 |
| InChI | InChI=1S/C8H10F2N2O/c1-2-6-3-8(12-5-11-6)13-4-7(9)10/h3,5,7H,2,4H2,1H3 |
| InChIKey | DVJAHJQPVJSSAJ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |