C17H25NO2S — CID 25129863
6-methoxy-1'-(3-methylbut-2-enyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] (PubChem CID 25129863) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is 6-methoxy-1'-(3-methylbut-2-enyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine].
| Compound Name | 6-methoxy-1'-(3-methylbut-2-enyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
|---|---|
| PubChem CID | 25129863 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 6-methoxy-1'-(3-methylbut-2-enyl)spiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine] |
| SMILES | COC1Cc2sccc2C2(CCN(CC=C(C)C)CC2)O1 |
| InChI | InChI=1S/C17H25NO2S/c1-13(2)4-8-18-9-6-17(7-10-18)14-5-11-21-15(14)12-16(19-3)20-17/h4-5,11,16H,6-10,12H2,1-3H3 |
| InChIKey | AOCHGAMNUIJVHV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|