C20H22O6 — CID 25131122
methyl (8R)-8-hydroxy-13,14,15-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4-carboxylate (PubChem CID 25131122) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl (8R)-8-hydroxy-13,14,15-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4-carboxylate.
| Compound Name | methyl (8R)-8-hydroxy-13,14,15-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 25131122 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl (8R)-8-hydroxy-13,14,15-trimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-4-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)-c1c(cc(OC)c(OC)c1OC)CC[C@H]2O |
| InChI | InChI=1S/C20H22O6/c1-23-16-10-11-6-8-15(21)13-7-5-12(20(22)26-4)9-14(13)17(11)19(25-3)18(16)24-2/h5,7,9-10,15,21H,6,8H2,1-4H3/t15-/m1/s1 |
| InChIKey | WPBLPDATOIGWOT-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |