C21H24N2O5 — CID 541129
methyl 8-acetamido-13-amino-14,15-dimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-5-carboxylate (PubChem CID 541129) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl 8-acetamido-13-amino-14,15-dimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-5-carboxylate.
| Compound Name | methyl 8-acetamido-13-amino-14,15-dimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 541129 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl 8-acetamido-13-amino-14,15-dimethoxytricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaene-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(NC(C)=O)CCc1cc(N)c(OC)c(OC)c1-2 |
| InChI | InChI=1S/C21H24N2O5/c1-11(24)23-17-8-6-12-10-16(22)19(26-2)20(27-3)18(12)14-7-5-13(9-15(14)17)21(25)28-4/h5,7,9-10,17H,6,8,22H2,1-4H3,(H,23,24) |
| InChIKey | CFFIMWXDEFXMPP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|