C21H23NO5Se — CID 53329514
N-(3-hydroxy-1,2-dimethoxy-10-methylselanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide (PubChem CID 53329514) has the molecular formula C21H23NO5Se and a molecular weight of 448.38 g/mol. Its IUPAC name is N-(3-hydroxy-1,2-dimethoxy-10-methylselanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide.
| Compound Name | N-(3-hydroxy-1,2-dimethoxy-10-methylselanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
|---|---|
| PubChem CID | 53329514 |
| Molecular Formula | C21H23NO5Se |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | N-(3-hydroxy-1,2-dimethoxy-10-methylselanyl-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl)acetamide |
| SMILES | COc1c(O)cc2c(c1OC)-c1ccc([Se]C)c(=O)cc1C(NC(C)=O)CC2 |
| InChI | InChI=1S/C21H23NO5Se/c1-11(23)22-15-7-5-12-9-17(25)20(26-2)21(27-3)19(12)13-6-8-18(28-4)16(24)10-14(13)15/h6,8-10,15,25H,5,7H2,1-4H3,(H,22,23) |
| InChIKey | BKLBERMHZJYDMV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|