C19H27NO4 — CID 25131412
ethyl 2-[2-[(5S)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoylamino]acetate (PubChem CID 25131412) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is ethyl 2-[2-[(5S)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoylamino]acetate.
| Compound Name | ethyl 2-[2-[(5S)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoylamino]acetate |
|---|---|
| PubChem CID | 25131412 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | ethyl 2-[2-[(5S)-3,8-dimethyl-2-oxo-4,5,6,7,8,8a-hexahydro-1H-azulen-5-yl]prop-2-enoylamino]acetate |
| SMILES | C=C(C(=O)NCC(=O)OCC)[C@H]1CCC(C)C2CC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C19H27NO4/c1-5-24-18(22)10-20-19(23)12(3)14-7-6-11(2)15-9-17(21)13(4)16(15)8-14/h11,14-15H,3,5-10H2,1-2,4H3,(H,20,23)/t11?,14-,15?/m0/s1 |
| InChIKey | UOLHWPVIPYLRAS-WPBUFGDCSA-N |
| XLogP | 2.56 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|