C23H28BrClN2O2 — CID 25134654
1-[3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propyl]-4-(4-chlorophenyl)piperazine (PubChem CID 25134654) has the molecular formula C23H28BrClN2O2 and a molecular weight of 479.85 g/mol. Its IUPAC name is 1-[3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propyl]-4-(4-chlorophenyl)piperazine.
| Compound Name | 1-[3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propyl]-4-(4-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 25134654 |
| Molecular Formula | C23H28BrClN2O2 |
| Molecular Weight | 479.85 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | 1-[3-[(5-bromo-2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]propyl]-4-(4-chlorophenyl)piperazine |
| SMILES | CC1(C)Cc2cc(Br)cc(OCCCN3CCN(c4ccc(Cl)cc4)CC3)c2O1 |
| InChI | InChI=1S/C23H28BrClN2O2/c1-23(2)16-17-14-18(24)15-21(22(17)29-23)28-13-3-8-26-9-11-27(12-10-26)20-6-4-19(25)5-7-20/h4-7,14-15H,3,8-13,16H2,1-2H3 |
| InChIKey | FQALJCNIUAPFRR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|