C23H28ClN3O4 — CID 69191058
1-(3-chlorophenyl)-4-[3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)oxy]propyl]piperazine (PubChem CID 69191058) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)oxy]propyl]piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)oxy]propyl]piperazine |
|---|---|
| PubChem CID | 69191058 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[3-[(2,2-dimethyl-5-nitro-3H-1-benzofuran-7-yl)oxy]propyl]piperazine |
| SMILES | CC1(C)Cc2cc([N+](=O)[O-])cc(OCCCN3CCN(c4cccc(Cl)c4)CC3)c2O1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-23(2)16-17-13-20(27(28)29)15-21(22(17)31-23)30-12-4-7-25-8-10-26(11-9-25)19-6-3-5-18(24)14-19/h3,5-6,13-15H,4,7-12,16H2,1-2H3 |
| InChIKey | ABKRUVKCCKRNAA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|