C25H24N4O3S — CID 2513761
4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-[(2R)-2-(3-methylphenoxy)propanoyl]benzohydrazide (PubChem CID 2513761) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-[(2R)-2-(3-methylphenoxy)propanoyl]benzohydrazide.
| Compound Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-[(2R)-2-(3-methylphenoxy)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 2513761 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylsulfanylmethyl)-N'-[(2R)-2-(3-methylphenoxy)propanoyl]benzohydrazide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)c2ccc(CSc3nc4ccccc4[nH]3)cc2)c1 |
| InChI | InChI=1S/C25H24N4O3S/c1-16-6-5-7-20(14-16)32-17(2)23(30)28-29-24(31)19-12-10-18(11-13-19)15-33-25-26-21-8-3-4-9-22(21)27-25/h3-14,17H,15H2,1-2H3,(H,26,27)(H,28,30)(H,29,31)/t17-/m1/s1 |
| InChIKey | GBYZTUMUTYTIND-QGZVFWFLSA-N |
| XLogP | 4.39 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|