About N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide
N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide (PubChem CID 25138077) has the molecular formula C19H21N5O3
and a molecular weight of 367.41 g/mol. Its IUPAC name is N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide |
| PubChem CID | 25138077 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide |
| SMILES | COc1cc(OC)cc(-c2cc(NC(C)=O)nc(-n3nc(C)cc3C)n2)c1 |
| InChI | InChI=1S/C19H21N5O3/c1-11-6-12(2)24(23-11)19-21-17(10-18(22-19)20-13(3)25)14-7-15(26-4)9-16(8-14)27-5/h6-10H,1-5H3,(H,20,21,22,25) |
| InChIKey | XGFRRYAZOMJDQL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
The IUPAC name of N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide (CID 25138077) is N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
The canonical SMILES for N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide is COc1cc(OC)cc(-c2cc(NC(C)=O)nc(-n3nc(C)cc3C)n2)c1.
What is the InChIKey of N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
The InChIKey is XGFRRYAZOMJDQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3/c1-11-6-12(2)24(23-11)19-21-17(10-18(22-19)20-13(3)25)14-7-15(26-4)9-16(8-14)27-5/h6-10H,1-5H3,(H,20,21,22,25).
What are the key properties of N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide?
N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide has a molecular weight of 367.41 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(3,5-dimethoxyphenyl)-2-(3,5-dimethylpyrazol-1-yl)pyrimidin-4-yl]acetamide is sourced from PubChem (CID 25138077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).