C24H17O4P — CID 25138423
6-hydroxy-4,8-diphenylbenzo[d][1,3,2]benzodioxaphosphepine 6-oxide (PubChem CID 25138423) has the molecular formula C24H17O4P and a molecular weight of 400.37 g/mol. Its IUPAC name is 6-hydroxy-4,8-diphenylbenzo[d][1,3,2]benzodioxaphosphepine 6-oxide.
| Compound Name | 6-hydroxy-4,8-diphenylbenzo[d][1,3,2]benzodioxaphosphepine 6-oxide |
|---|---|
| PubChem CID | 25138423 |
| Molecular Formula | C24H17O4P |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | 6-hydroxy-4,8-diphenylbenzo[d][1,3,2]benzodioxaphosphepine 6-oxide |
| SMILES | O=P1(O)Oc2c(-c3ccccc3)cccc2-c2cccc(-c3ccccc3)c2O1 |
| InChI | InChI=1S/C24H17O4P/c25-29(26)27-23-19(17-9-3-1-4-10-17)13-7-15-21(23)22-16-8-14-20(24(22)28-29)18-11-5-2-6-12-18/h1-16H,(H,25,26) |
| InChIKey | LMJUHFDILYTWSK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|