C38H42N2O5 — CID 25139557
4-N,6-N-bis[(1R)-1-(4-tert-butylphenyl)-2-hydroxyethyl]dibenzofuran-4,6-dicarboxamide (PubChem CID 25139557) has the molecular formula C38H42N2O5 and a molecular weight of 606.76 g/mol. Its IUPAC name is 4-N,6-N-bis[(1R)-1-(4-tert-butylphenyl)-2-hydroxyethyl]dibenzofuran-4,6-dicarboxamide.
| Compound Name | 4-N,6-N-bis[(1R)-1-(4-tert-butylphenyl)-2-hydroxyethyl]dibenzofuran-4,6-dicarboxamide |
|---|---|
| PubChem CID | 25139557 |
| Molecular Formula | C38H42N2O5 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | 4-N,6-N-bis[(1R)-1-(4-tert-butylphenyl)-2-hydroxyethyl]dibenzofuran-4,6-dicarboxamide |
| SMILES | CC(C)(C)c1ccc([C@H](CO)NC(=O)c2cccc3c2oc2c(C(=O)N[C@@H](CO)c4ccc(C(C)(C)C)cc4)cccc23)cc1 |
| InChI | InChI=1S/C38H42N2O5/c1-37(2,3)25-17-13-23(14-18-25)31(21-41)39-35(43)29-11-7-9-27-28-10-8-12-30(34(28)45-33(27)29)36(44)40-32(22-42)24-15-19-26(20-16-24)38(4,5)6/h7-20,31-32,41-42H,21-22H2,1-6H3,(H,39,43)(H,40,44)/t31-,32-/m0/s1 |
| InChIKey | ADEKVSXERWEJKT-ACHIHNKUSA-N |
| XLogP | 7.11 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |