C21H21N5O4 — CID 25140418
8,9-bis(3,4-dimethoxyphenyl)purin-6-amine (PubChem CID 25140418) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 8,9-bis(3,4-dimethoxyphenyl)purin-6-amine.
| Compound Name | 8,9-bis(3,4-dimethoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 25140418 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 8,9-bis(3,4-dimethoxyphenyl)purin-6-amine |
| SMILES | COc1ccc(-c2nc3c(N)ncnc3n2-c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C21H21N5O4/c1-27-14-7-5-12(9-16(14)29-3)20-25-18-19(22)23-11-24-21(18)26(20)13-6-8-15(28-2)17(10-13)30-4/h5-11H,1-4H3,(H2,22,23,24) |
| InChIKey | YSFCYTOCWWOSJR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |