C34H31N5O5 — CID 25138816
9-(3,4-dimethoxyphenyl)-N,N,8-tris(4-methoxyphenyl)purin-6-amine (PubChem CID 25138816) has the molecular formula C34H31N5O5 and a molecular weight of 589.65 g/mol. Its IUPAC name is 9-(3,4-dimethoxyphenyl)-N,N,8-tris(4-methoxyphenyl)purin-6-amine.
| Compound Name | 9-(3,4-dimethoxyphenyl)-N,N,8-tris(4-methoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 25138816 |
| Molecular Formula | C34H31N5O5 |
| Molecular Weight | 589.65 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 9-(3,4-dimethoxyphenyl)-N,N,8-tris(4-methoxyphenyl)purin-6-amine |
| SMILES | COc1ccc(-c2nc3c(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ncnc3n2-c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C34H31N5O5/c1-40-26-13-6-22(7-14-26)32-37-31-33(35-21-36-34(31)39(32)25-12-19-29(43-4)30(20-25)44-5)38(23-8-15-27(41-2)16-9-23)24-10-17-28(42-3)18-11-24/h6-21H,1-5H3 |
| InChIKey | TZMVGXYOZRQFNI-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.65 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |