C27H32N6O2 — CID 25141999
2-[4-[[2-(1H-indol-4-yl)-4-morpholin-4-ylquinazolin-6-yl]methyl]piperazin-1-yl]ethanol (PubChem CID 25141999) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[4-[[2-(1H-indol-4-yl)-4-morpholin-4-ylquinazolin-6-yl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[2-(1H-indol-4-yl)-4-morpholin-4-ylquinazolin-6-yl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 25141999 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 2-[4-[[2-(1H-indol-4-yl)-4-morpholin-4-ylquinazolin-6-yl]methyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(Cc2ccc3nc(-c4cccc5[nH]ccc45)nc(N4CCOCC4)c3c2)CC1 |
| InChI | InChI=1S/C27H32N6O2/c34-15-12-31-8-10-32(11-9-31)19-20-4-5-25-23(18-20)27(33-13-16-35-17-14-33)30-26(29-25)22-2-1-3-24-21(22)6-7-28-24/h1-7,18,28,34H,8-17,19H2 |
| InChIKey | QUNXVQLTODGQLK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |