C26H26N6O2S — CID 66927629
4-[4-(1H-indol-4-yl)-12-(morpholin-4-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine (PubChem CID 66927629) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 4-[4-(1H-indol-4-yl)-12-(morpholin-4-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine.
| Compound Name | 4-[4-(1H-indol-4-yl)-12-(morpholin-4-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine |
|---|---|
| PubChem CID | 66927629 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4-[4-(1H-indol-4-yl)-12-(morpholin-4-ylmethyl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine |
| SMILES | c1cc(-c2nc(N3CCOCC3)c3sc4ncc(CN5CCOCC5)cc4c3n2)c2cc[nH]c2c1 |
| InChI | InChI=1S/C26H26N6O2S/c1-2-19(18-4-5-27-21(18)3-1)24-29-22-20-14-17(16-31-6-10-33-11-7-31)15-28-26(20)35-23(22)25(30-24)32-8-12-34-13-9-32/h1-5,14-15,27H,6-13,16H2 |
| InChIKey | DVZPBASJSGFKOG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |