C25H25FN4O3 — CID 25142009
9a-(4-fluorophenyl)-4-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,6,7,9-tetrahydro-[1,4]oxazino[4,3-d][1,2,4]oxadiazine (PubChem CID 25142009) has the molecular formula C25H25FN4O3 and a molecular weight of 448.50 g/mol. Its IUPAC name is 9a-(4-fluorophenyl)-4-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,6,7,9-tetrahydro-[1,4]oxazino[4,3-d][1,2,4]oxadiazine.
| Compound Name | 9a-(4-fluorophenyl)-4-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,6,7,9-tetrahydro-[1,4]oxazino[4,3-d][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 25142009 |
| Molecular Formula | C25H25FN4O3 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 9a-(4-fluorophenyl)-4-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]-1,6,7,9-tetrahydro-[1,4]oxazino[4,3-d][1,2,4]oxadiazine |
| SMILES | COc1cc(/C=C/C2=NOCC3(c4ccc(F)cc4)COCCN23)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C25H25FN4O3/c1-18-14-29(17-27-18)22-9-3-19(13-23(22)31-2)4-10-24-28-33-16-25(15-32-12-11-30(24)25)20-5-7-21(26)8-6-20/h3-10,13-14,17H,11-12,15-16H2,1-2H3/b10-4+ |
| InChIKey | OFAJZJXTLSRGDI-ONNFQVAWSA-N |
| XLogP | 3.91 |
| TPSA | 61.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |