C27H29FN4O2 — CID 70291712
(9E)-4-ethyl-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine (PubChem CID 70291712) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is (9E)-4-ethyl-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine.
| Compound Name | (9E)-4-ethyl-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine |
|---|---|
| PubChem CID | 70291712 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | (9E)-4-ethyl-4-(4-fluorophenyl)-9-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-3,6,7,8-tetrahydropyrido[2,1-c][1,2,4]oxadiazine |
| SMILES | CCC1(c2ccc(F)cc2)CON=C2/C(=C/c3ccc(-n4cnc(C)c4)c(OC)c3)CCCN21 |
| InChI | InChI=1S/C27H29FN4O2/c1-4-27(22-8-10-23(28)11-9-22)17-34-30-26-21(6-5-13-32(26)27)14-20-7-12-24(25(15-20)33-3)31-16-19(2)29-18-31/h7-12,14-16,18H,4-6,13,17H2,1-3H3/b21-14+ |
| InChIKey | CVZIHEJWIBZMKM-KGENOOAVSA-N |
| XLogP | 5.46 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |