C13H11Cl2NO2 — CID 25144342
4,7-dichloro-2-cyclopentylisoindole-1,3-dione (PubChem CID 25144342) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is 4,7-dichloro-2-cyclopentylisoindole-1,3-dione.
| Compound Name | 4,7-dichloro-2-cyclopentylisoindole-1,3-dione |
|---|---|
| PubChem CID | 25144342 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 4,7-dichloro-2-cyclopentylisoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)ccc(Cl)c2C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C13H11Cl2NO2/c14-8-5-6-9(15)11-10(8)12(17)16(13(11)18)7-3-1-2-4-7/h5-7H,1-4H2 |
| InChIKey | MJHLGZLKIAAXFS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|