C9H13NO4 — CID 25146758
1-(2-oxo-1,3-oxazolidin-3-yl)hexane-1,3-dione (PubChem CID 25146758) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-(2-oxo-1,3-oxazolidin-3-yl)hexane-1,3-dione.
| Compound Name | 1-(2-oxo-1,3-oxazolidin-3-yl)hexane-1,3-dione |
|---|---|
| PubChem CID | 25146758 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-(2-oxo-1,3-oxazolidin-3-yl)hexane-1,3-dione |
| SMILES | CCCC(=O)CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C9H13NO4/c1-2-3-7(11)6-8(12)10-4-5-14-9(10)13/h2-6H2,1H3 |
| InChIKey | PJBIMBMRDYRISB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|