C20H27NO2 — CID 25147287
(1S,5S,8R,9R,11R,13S,14S,17R,18R)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadec-6-ene-13,17-diol (PubChem CID 25147287) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (1S,5S,8R,9R,11R,13S,14S,17R,18R)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadec-6-ene-13,17-diol.
| Compound Name | (1S,5S,8R,9R,11R,13S,14S,17R,18R)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadec-6-ene-13,17-diol |
|---|---|
| PubChem CID | 25147287 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (1S,5S,8R,9R,11R,13S,14S,17R,18R)-5-methyl-12-methylidene-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadec-6-ene-13,17-diol |
| SMILES | C=C1[C@@H]2C[C@@H]3[C@]4(CC[C@@]5(O)[C@@]36CCC[C@@]5(C)C=N[C@@H]6[C@@H]4C2)[C@H]1O |
| InChI | InChI=1S/C20H27NO2/c1-11-12-8-13-15-19-5-3-4-17(2,10-21-15)20(19,23)7-6-18(13,16(11)22)14(19)9-12/h10,12-16,22-23H,1,3-9H2,2H3/t12-,13-,14+,15+,16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | KTNFGMKTBBPQCI-FPGPFZBPSA-N |
| XLogP | 2.71 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|