C29H25NO6 — CID 25148014
methyl 7-[2-[5-methyl-2-(4-phenylphenyl)-1,3-oxazol-4-yl]ethoxy]-2-oxo-3,4-dihydrochromene-3-carboxylate (PubChem CID 25148014) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is methyl 7-[2-[5-methyl-2-(4-phenylphenyl)-1,3-oxazol-4-yl]ethoxy]-2-oxo-3,4-dihydrochromene-3-carboxylate.
| Compound Name | methyl 7-[2-[5-methyl-2-(4-phenylphenyl)-1,3-oxazol-4-yl]ethoxy]-2-oxo-3,4-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 25148014 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | methyl 7-[2-[5-methyl-2-(4-phenylphenyl)-1,3-oxazol-4-yl]ethoxy]-2-oxo-3,4-dihydrochromene-3-carboxylate |
| SMILES | COC(=O)C1Cc2ccc(OCCc3nc(-c4ccc(-c5ccccc5)cc4)oc3C)cc2OC1=O |
| InChI | InChI=1S/C29H25NO6/c1-18-25(30-27(35-18)21-10-8-20(9-11-21)19-6-4-3-5-7-19)14-15-34-23-13-12-22-16-24(28(31)33-2)29(32)36-26(22)17-23/h3-13,17,24H,14-16H2,1-2H3 |
| InChIKey | ZTWQZGIOXRCDQP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|