C27H31NO5 — CID 69279615
2-tert-butyl-7-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]-3,4-dihydro-2H-chromene-3-carboxylic acid (PubChem CID 69279615) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is 2-tert-butyl-7-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]-3,4-dihydro-2H-chromene-3-carboxylic acid.
| Compound Name | 2-tert-butyl-7-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]-3,4-dihydro-2H-chromene-3-carboxylic acid |
|---|---|
| PubChem CID | 69279615 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-tert-butyl-7-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propoxy]-3,4-dihydro-2H-chromene-3-carboxylic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCCOc1ccc2c(c1)OC(C(C)(C)C)C(C(=O)O)C2 |
| InChI | InChI=1S/C27H31NO5/c1-17-22(28-25(32-17)18-9-6-5-7-10-18)11-8-14-31-20-13-12-19-15-21(26(29)30)24(27(2,3)4)33-23(19)16-20/h5-7,9-10,12-13,16,21,24H,8,11,14-15H2,1-4H3,(H,29,30) |
| InChIKey | IYFGRVWWUVLCTC-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|