C21H16Cl2N6 — CID 25148231
4-azido-5-(2-chloroethyl)-3-(4-chlorophenyl)-6-methyl-1-phenylpyrazolo[3,4-b]pyridine (PubChem CID 25148231) has the molecular formula C21H16Cl2N6 and a molecular weight of 423.31 g/mol. Its IUPAC name is 4-azido-5-(2-chloroethyl)-3-(4-chlorophenyl)-6-methyl-1-phenylpyrazolo[3,4-b]pyridine.
| Compound Name | 4-azido-5-(2-chloroethyl)-3-(4-chlorophenyl)-6-methyl-1-phenylpyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 25148231 |
| Molecular Formula | C21H16Cl2N6 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 4-azido-5-(2-chloroethyl)-3-(4-chlorophenyl)-6-methyl-1-phenylpyrazolo[3,4-b]pyridine |
| SMILES | Cc1nc2c(c(-c3ccc(Cl)cc3)nn2-c2ccccc2)c(N=[N+]=[N-])c1CCCl |
| InChI | InChI=1S/C21H16Cl2N6/c1-13-17(11-12-22)20(26-28-24)18-19(14-7-9-15(23)10-8-14)27-29(21(18)25-13)16-5-3-2-4-6-16/h2-10H,11-12H2,1H3 |
| InChIKey | YTUAEFCNWGTESP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|