C21H16BrN3S — CID 25148312
12-(4-bromophenyl)-7-methyl-10-phenyl-3-thia-8,10,11-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene (PubChem CID 25148312) has the molecular formula C21H16BrN3S and a molecular weight of 422.35 g/mol. Its IUPAC name is 12-(4-bromophenyl)-7-methyl-10-phenyl-3-thia-8,10,11-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene.
| Compound Name | 12-(4-bromophenyl)-7-methyl-10-phenyl-3-thia-8,10,11-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene |
|---|---|
| PubChem CID | 25148312 |
| Molecular Formula | C21H16BrN3S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 12-(4-bromophenyl)-7-methyl-10-phenyl-3-thia-8,10,11-triazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraene |
| SMILES | Cc1nc2c(c(-c3ccc(Br)cc3)nn2-c2ccccc2)c2c1CCS2 |
| InChI | InChI=1S/C21H16BrN3S/c1-13-17-11-12-26-20(17)18-19(14-7-9-15(22)10-8-14)24-25(21(18)23-13)16-5-3-2-4-6-16/h2-10H,11-12H2,1H3 |
| InChIKey | QILPEWQDUOAMGU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |