C36H24Br2N6 — CID 71697009
8,16-bis(4-bromophenyl)-5,13-dimethyl-3,11-diphenyl-4,5,7,12,13,15-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),3,7,10(14),11,15-heptaene (PubChem CID 71697009) has the molecular formula C36H24Br2N6 and a molecular weight of 700.44 g/mol. Its IUPAC name is 8,16-bis(4-bromophenyl)-5,13-dimethyl-3,11-diphenyl-4,5,7,12,13,15-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),3,7,10(14),11,15-heptaene.
| Compound Name | 8,16-bis(4-bromophenyl)-5,13-dimethyl-3,11-diphenyl-4,5,7,12,13,15-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),3,7,10(14),11,15-heptaene |
|---|---|
| PubChem CID | 71697009 |
| Molecular Formula | C36H24Br2N6 |
| Molecular Weight | 700.44 g/mol |
| Exact Mass | 698.04 |
| IUPAC Name | 8,16-bis(4-bromophenyl)-5,13-dimethyl-3,11-diphenyl-4,5,7,12,13,15-hexazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),2(6),3,7,10(14),11,15-heptaene |
| SMILES | Cn1nc(-c2ccccc2)c2c3c(-c4ccc(Br)cc4)nc4c(c(-c5ccccc5)nn4C)c3c(-c3ccc(Br)cc3)nc21 |
| InChI | InChI=1S/C36H24Br2N6/c1-43-35-29(33(41-43)21-9-5-3-6-10-21)27-28(31(39-35)23-13-17-25(37)18-14-23)30-34(22-11-7-4-8-12-22)42-44(2)36(30)40-32(27)24-15-19-26(38)20-16-24/h3-20H,1-2H3 |
| InChIKey | SIZOCBBUJBCYIG-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.44 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |