C21H15F6N5O3S2 — CID 25150350
[2-[2,4-bis(trifluoromethyl)anilino]-6-methyl-4-[3-(1,3-thiazol-2-yl)pyrazol-1-yl]-3-pyridinyl]methanesulfonic acid (PubChem CID 25150350) has the molecular formula C21H15F6N5O3S2 and a molecular weight of 563.51 g/mol. Its IUPAC name is [2-[2,4-bis(trifluoromethyl)anilino]-6-methyl-4-[3-(1,3-thiazol-2-yl)pyrazol-1-yl]-3-pyridinyl]methanesulfonic acid.
| Compound Name | [2-[2,4-bis(trifluoromethyl)anilino]-6-methyl-4-[3-(1,3-thiazol-2-yl)pyrazol-1-yl]-3-pyridinyl]methanesulfonic acid |
|---|---|
| PubChem CID | 25150350 |
| Molecular Formula | C21H15F6N5O3S2 |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.05 |
| IUPAC Name | [2-[2,4-bis(trifluoromethyl)anilino]-6-methyl-4-[3-(1,3-thiazol-2-yl)pyrazol-1-yl]-3-pyridinyl]methanesulfonic acid |
| SMILES | Cc1cc(-n2ccc(-c3nccs3)n2)c(CS(=O)(=O)O)c(Nc2ccc(C(F)(F)F)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C21H15F6N5O3S2/c1-11-8-17(32-6-4-16(31-32)19-28-5-7-36-19)13(10-37(33,34)35)18(29-11)30-15-3-2-12(20(22,23)24)9-14(15)21(25,26)27/h2-9H,10H2,1H3,(H,29,30)(H,33,34,35) |
| InChIKey | GPPKSVIUBJGWND-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|