C13H11F3N4S — CID 58990910
N-[1-ethyl-5-(trifluoromethyl)indazol-3-yl]-1,3-thiazol-2-amine (PubChem CID 58990910) has the molecular formula C13H11F3N4S and a molecular weight of 312.32 g/mol. Its IUPAC name is N-[1-ethyl-5-(trifluoromethyl)indazol-3-yl]-1,3-thiazol-2-amine.
| Compound Name | N-[1-ethyl-5-(trifluoromethyl)indazol-3-yl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58990910 |
| Molecular Formula | C13H11F3N4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[1-ethyl-5-(trifluoromethyl)indazol-3-yl]-1,3-thiazol-2-amine |
| SMILES | CCn1nc(Nc2nccs2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C13H11F3N4S/c1-2-20-10-4-3-8(13(14,15)16)7-9(10)11(19-20)18-12-17-5-6-21-12/h3-7H,2H2,1H3,(H,17,18,19) |
| InChIKey | JPUVOLHNKNMYRD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |