C18H21F3N4S — CID 152897643
1-(4-aminobutyl)-N-(4,5-dihydrothiepin-2-yl)-5-(trifluoromethyl)indazol-3-amine (PubChem CID 152897643) has the molecular formula C18H21F3N4S and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-(4-aminobutyl)-N-(4,5-dihydrothiepin-2-yl)-5-(trifluoromethyl)indazol-3-amine.
| Compound Name | 1-(4-aminobutyl)-N-(4,5-dihydrothiepin-2-yl)-5-(trifluoromethyl)indazol-3-amine |
|---|---|
| PubChem CID | 152897643 |
| Molecular Formula | C18H21F3N4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1-(4-aminobutyl)-N-(4,5-dihydrothiepin-2-yl)-5-(trifluoromethyl)indazol-3-amine |
| SMILES | NCCCCn1nc(NC2=CCCC=CS2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C18H21F3N4S/c19-18(20,21)13-7-8-15-14(12-13)17(24-25(15)10-4-3-9-22)23-16-6-2-1-5-11-26-16/h5-8,11-12H,1-4,9-10,22H2,(H,23,24) |
| InChIKey | UERWNAVJAKPBBV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|