C18H14FN5O2S — CID 25151600
2-fluoro-N-hydroxy-4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide (PubChem CID 25151600) has the molecular formula C18H14FN5O2S and a molecular weight of 383.41 g/mol. Its IUPAC name is 2-fluoro-N-hydroxy-4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide.
| Compound Name | 2-fluoro-N-hydroxy-4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 25151600 |
| Molecular Formula | C18H14FN5O2S |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 2-fluoro-N-hydroxy-4-[[4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-yl]amino]benzamide |
| SMILES | Cc1nc2ccccn2c1-c1csc(Nc2ccc(C(=O)NO)c(F)c2)n1 |
| InChI | InChI=1S/C18H14FN5O2S/c1-10-16(24-7-3-2-4-15(24)20-10)14-9-27-18(22-14)21-11-5-6-12(13(19)8-11)17(25)23-26/h2-9,26H,1H3,(H,21,22)(H,23,25) |
| InChIKey | ZGUZRPOOYPOXNI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|