C31H36N6O4 — CID 25154488
4-[2-butoxy-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 25154488) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is 4-[2-butoxy-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-butoxy-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 25154488 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 4-[2-butoxy-6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidin-4-yl]-N-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | CCCCOc1nc(N2CCN(C(=O)Nc3cccc(C)c3)CC2)c2nc(-c3ccc(OC)c(OC)c3)ccc2n1 |
| InChI | InChI=1S/C31H36N6O4/c1-5-6-18-41-30-34-25-12-11-24(22-10-13-26(39-3)27(20-22)40-4)33-28(25)29(35-30)36-14-16-37(17-15-36)31(38)32-23-9-7-8-21(2)19-23/h7-13,19-20H,5-6,14-18H2,1-4H3,(H,32,38) |
| InChIKey | GERCRVFXGSRJJV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|