C30H34FN7O4 — CID 25154641
[4-[(16E)-3-fluoro-14,20-dioxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]piperazin-1-yl]-morpholin-4-ylmethanone (PubChem CID 25154641) has the molecular formula C30H34FN7O4 and a molecular weight of 575.65 g/mol. Its IUPAC name is [4-[(16E)-3-fluoro-14,20-dioxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]piperazin-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [4-[(16E)-3-fluoro-14,20-dioxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]piperazin-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 25154641 |
| Molecular Formula | C30H34FN7O4 |
| Molecular Weight | 575.65 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | [4-[(16E)-3-fluoro-14,20-dioxa-5,7,22,27-tetrazatetracyclo[19.3.1.12,6.18,12]heptacosa-1(25),2(27),3,5,8(26),9,11,16,21,23-decaen-11-yl]piperazin-1-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(N1CCOCC1)N1CCN(c2ccc3cc2COC/C=C/CCOc2cc(ccn2)-c2nc(ncc2F)N3)CC1 |
| InChI | InChI=1S/C30H34FN7O4/c31-25-20-33-29-34-24-4-5-26(36-8-10-37(11-9-36)30(39)38-12-16-40-17-13-38)23(18-24)21-41-14-2-1-3-15-42-27-19-22(6-7-32-27)28(25)35-29/h1-2,4-7,18-20H,3,8-17,21H2,(H,33,34,35)/b2-1+ |
| InChIKey | KLKOIWLDXPEQOR-OWOJBTEDSA-N |
| XLogP | 3.85 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|