C15H10FNO2S — CID 25155057
(1Z)-1-[(4-fluorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one (PubChem CID 25155057) has the molecular formula C15H10FNO2S and a molecular weight of 287.31 g/mol. Its IUPAC name is (1Z)-1-[(4-fluorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one.
| Compound Name | (1Z)-1-[(4-fluorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 25155057 |
| Molecular Formula | C15H10FNO2S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | (1Z)-1-[(4-fluorophenyl)methylidene]-6-methyl-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
| SMILES | Cc1cc2c(c(=S)[nH]1)C(=O)O/C2=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C15H10FNO2S/c1-8-6-11-12(7-9-2-4-10(16)5-3-9)19-15(18)13(11)14(20)17-8/h2-7H,1H3,(H,17,20)/b12-7- |
| InChIKey | RNAOAKKAGKAYQB-GHXNOFRVSA-N |
| XLogP | 3.86 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_J(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|