C16H13NO2S2 — CID 25156420
(1Z)-6-methyl-1-[(4-methylsulfanylphenyl)methylidene]-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one (PubChem CID 25156420) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (1Z)-6-methyl-1-[(4-methylsulfanylphenyl)methylidene]-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one.
| Compound Name | (1Z)-6-methyl-1-[(4-methylsulfanylphenyl)methylidene]-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
|---|---|
| PubChem CID | 25156420 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (1Z)-6-methyl-1-[(4-methylsulfanylphenyl)methylidene]-4-sulfanylidene-5H-furo[3,4-c]pyridin-3-one |
| SMILES | CSc1ccc(/C=C2\OC(=O)c3c2cc(C)[nH]c3=S)cc1 |
| InChI | InChI=1S/C16H13NO2S2/c1-9-7-12-13(19-16(18)14(12)15(20)17-9)8-10-3-5-11(21-2)6-4-10/h3-8H,1-2H3,(H,17,20)/b13-8- |
| InChIKey | AYAGVBNSBFUJBF-JYRVWZFOSA-N |
| XLogP | 4.44 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_J(4)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|