C11H19NO — CID 25155273
[(2S)-5,5-bis(prop-2-enyl)pyrrolidin-2-yl]methanol (PubChem CID 25155273) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is [(2S)-5,5-bis(prop-2-enyl)pyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-5,5-bis(prop-2-enyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 25155273 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | [(2S)-5,5-bis(prop-2-enyl)pyrrolidin-2-yl]methanol |
| SMILES | C=CCC1(CC=C)CC[C@@H](CO)N1 |
| InChI | InChI=1S/C11H19NO/c1-3-6-11(7-4-2)8-5-10(9-13)12-11/h3-4,10,12-13H,1-2,5-9H2/t10-/m0/s1 |
| InChIKey | OELXLSJFZZIYAB-JTQLQIEISA-N |
| XLogP | 1.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|