C17H17ClN2 — CID 25155800
2-(4-chlorophenyl)-2-(3-phenylpropylamino)acetonitrile (PubChem CID 25155800) has the molecular formula C17H17ClN2 and a molecular weight of 284.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(3-phenylpropylamino)acetonitrile.
| Compound Name | 2-(4-chlorophenyl)-2-(3-phenylpropylamino)acetonitrile |
|---|---|
| PubChem CID | 25155800 |
| Molecular Formula | C17H17ClN2 |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(3-phenylpropylamino)acetonitrile |
| SMILES | N#CC(NCCCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN2/c18-16-10-8-15(9-11-16)17(13-19)20-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11,17,20H,4,7,12H2 |
| InChIKey | XEEVOGNHFYUJMT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|