C17H28O3 — CID 25158373
(1S,6R,7R)-7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one (PubChem CID 25158373) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (1S,6R,7R)-7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one.
| Compound Name | (1S,6R,7R)-7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one |
|---|---|
| PubChem CID | 25158373 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (1S,6R,7R)-7-(3,3-dimethoxybutyl)-1-methyl-4-propan-2-ylidenebicyclo[4.1.0]heptan-3-one |
| SMILES | COC(C)(CC[C@@H]1[C@H]2CC(=C(C)C)C(=O)C[C@@]12C)OC |
| InChI | InChI=1S/C17H28O3/c1-11(2)12-9-14-13(16(14,3)10-15(12)18)7-8-17(4,19-5)20-6/h13-14H,7-10H2,1-6H3/t13-,14-,16+/m1/s1 |
| InChIKey | CTPMWRPBFHLHQU-FMKPAKJESA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|