C26H42O3 — CID 25158952
[(1R,5aS,5bS,7aS,11aR,11bS,13aS,13bR)-1-methoxy-5b,8,8,13a-tetramethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[2,1-e][2]benzofuran-11a-yl]methanol (PubChem CID 25158952) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is [(1R,5aS,5bS,7aS,11aR,11bS,13aS,13bR)-1-methoxy-5b,8,8,13a-tetramethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[2,1-e][2]benzofuran-11a-yl]methanol.
| Compound Name | [(1R,5aS,5bS,7aS,11aR,11bS,13aS,13bR)-1-methoxy-5b,8,8,13a-tetramethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[2,1-e][2]benzofuran-11a-yl]methanol |
|---|---|
| PubChem CID | 25158952 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | [(1R,5aS,5bS,7aS,11aR,11bS,13aS,13bR)-1-methoxy-5b,8,8,13a-tetramethyl-1,3,5,5a,6,7,7a,9,10,11,11b,12,13,13b-tetradecahydrophenanthro[2,1-e][2]benzofuran-11a-yl]methanol |
| SMILES | CO[C@@H]1OCC2=CC[C@@H]3[C@](C)(CC[C@H]4[C@@]3(C)CC[C@H]3C(C)(C)CCC[C@@]34CO)[C@H]21 |
| InChI | InChI=1S/C26H42O3/c1-23(2)11-6-12-26(16-27)18(23)9-13-24(3)19-8-7-17-15-29-22(28-5)21(17)25(19,4)14-10-20(24)26/h7,18-22,27H,6,8-16H2,1-5H3/t18-,19-,20-,21+,22+,24-,25-,26+/m0/s1 |
| InChIKey | QZOGSLSUTNSYEO-WAEZVMSBSA-N |
| XLogP | 5.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|