C23H19F3N2O3 — CID 25159388
N-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-2-[(1-phenylcyclopropyl)methyl]pent-3-ynamide (PubChem CID 25159388) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-2-[(1-phenylcyclopropyl)methyl]pent-3-ynamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-2-[(1-phenylcyclopropyl)methyl]pent-3-ynamide |
|---|---|
| PubChem CID | 25159388 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2,5-dihydroxy-2-[(1-phenylcyclopropyl)methyl]pent-3-ynamide |
| SMILES | N#Cc1ccc(NC(=O)C(O)(C#CCO)CC2(c3ccccc3)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C23H19F3N2O3/c24-23(25,26)19-13-18(8-7-16(19)14-27)28-20(30)22(31,9-4-12-29)15-21(10-11-21)17-5-2-1-3-6-17/h1-3,5-8,13,29,31H,10-12,15H2,(H,28,30) |
| InChIKey | FZTHCGRVHLBIJK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|