C24H37ClN4O4 — CID 25160194
(2S)-6-amino-2-[[(2R)-1-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid (PubChem CID 25160194) has the molecular formula C24H37ClN4O4 and a molecular weight of 481.04 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-1-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-1-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 25160194 |
| Molecular Formula | C24H37ClN4O4 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-1-[[(1S)-1-(4-chlorophenyl)ethyl]amino]-3-cyclohexyl-1-oxopropan-2-yl]carbamoylamino]hexanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](CC1CCCCC1)NC(=O)N[C@@H](CCCCN)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H37ClN4O4/c1-16(18-10-12-19(25)13-11-18)27-22(30)21(15-17-7-3-2-4-8-17)29-24(33)28-20(23(31)32)9-5-6-14-26/h10-13,16-17,20-21H,2-9,14-15,26H2,1H3,(H,27,30)(H,31,32)(H2,28,29,33)/t16-,20-,21+/m0/s1 |
| InChIKey | XPYKQDYZHBTVDV-ORYQWCPZSA-N |
| XLogP | 3.74 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|