C17H19BrN2O3S2 — CID 25161491
3-(benzenesulfonamido)-N-[2-(4-bromophenyl)sulfanylethyl]propanamide (PubChem CID 25161491) has the molecular formula C17H19BrN2O3S2 and a molecular weight of 443.39 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[2-(4-bromophenyl)sulfanylethyl]propanamide.
| Compound Name | 3-(benzenesulfonamido)-N-[2-(4-bromophenyl)sulfanylethyl]propanamide |
|---|---|
| PubChem CID | 25161491 |
| Molecular Formula | C17H19BrN2O3S2 |
| Molecular Weight | 443.39 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[2-(4-bromophenyl)sulfanylethyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccccc1)NCCSc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H19BrN2O3S2/c18-14-6-8-15(9-7-14)24-13-12-19-17(21)10-11-20-25(22,23)16-4-2-1-3-5-16/h1-9,20H,10-13H2,(H,19,21) |
| InChIKey | RHKABXHVJGZYIV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|