C16H29N7O3 — CID 25162989
(4S)-4-[4-(1,5-diaminopentyl)triazol-1-yl]-5-oxo-5-piperazin-1-ylpentanoic acid (PubChem CID 25162989) has the molecular formula C16H29N7O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (4S)-4-[4-(1,5-diaminopentyl)triazol-1-yl]-5-oxo-5-piperazin-1-ylpentanoic acid.
| Compound Name | (4S)-4-[4-(1,5-diaminopentyl)triazol-1-yl]-5-oxo-5-piperazin-1-ylpentanoic acid |
|---|---|
| PubChem CID | 25162989 |
| Molecular Formula | C16H29N7O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | (4S)-4-[4-(1,5-diaminopentyl)triazol-1-yl]-5-oxo-5-piperazin-1-ylpentanoic acid |
| SMILES | NCCCCC(N)c1cn([C@@H](CCC(=O)O)C(=O)N2CCNCC2)nn1 |
| InChI | InChI=1S/C16H29N7O3/c17-6-2-1-3-12(18)13-11-23(21-20-13)14(4-5-15(24)25)16(26)22-9-7-19-8-10-22/h11-12,14,19H,1-10,17-18H2,(H,24,25)/t12?,14-/m0/s1 |
| InChIKey | OODKKERUMDHHBO-PYMCNQPYSA-N |
| XLogP | -0.76 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|