C25H30N4O6S — CID 25163245
1-(2-butan-2-ylphenyl)-4-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 25163245) has the molecular formula C25H30N4O6S and a molecular weight of 514.60 g/mol. Its IUPAC name is 1-(2-butan-2-ylphenyl)-4-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-(2-butan-2-ylphenyl)-4-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 25163245 |
| Molecular Formula | C25H30N4O6S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 1-(2-butan-2-ylphenyl)-4-[4-(3-nitrophenyl)sulfonylpiperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | CCC(C)c1ccccc1N1CC(C(=O)N2CCN(S(=O)(=O)c3cccc([N+](=O)[O-])c3)CC2)CC1=O |
| InChI | InChI=1S/C25H30N4O6S/c1-3-18(2)22-9-4-5-10-23(22)28-17-19(15-24(28)30)25(31)26-11-13-27(14-12-26)36(34,35)21-8-6-7-20(16-21)29(32)33/h4-10,16,18-19H,3,11-15,17H2,1-2H3 |
| InChIKey | KVQMVRLBTFVAMP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 121.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|