C25H28BrN3O4 — CID 2516603
(E)-3-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide (PubChem CID 2516603) has the molecular formula C25H28BrN3O4 and a molecular weight of 514.42 g/mol. Its IUPAC name is (E)-3-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2516603 |
| Molecular Formula | C25H28BrN3O4 |
| Molecular Weight | 514.42 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | (E)-3-[3-bromo-4-[2-(dimethylamino)-2-oxoethoxy]-5-ethoxyphenyl]-2-cyano-N-(2,4,6-trimethylphenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2c(C)cc(C)cc2C)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C25H28BrN3O4/c1-7-32-21-12-18(11-20(26)24(21)33-14-22(30)29(5)6)10-19(13-27)25(31)28-23-16(3)8-15(2)9-17(23)4/h8-12H,7,14H2,1-6H3,(H,28,31)/b19-10+ |
| InChIKey | ODDOBEJPZHUZBY-VXLYETTFSA-N |
| XLogP | 4.79 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|