C26H27F3N6O4 — CID 25167581
N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]benzamide (PubChem CID 25167581) has the molecular formula C26H27F3N6O4 and a molecular weight of 544.53 g/mol. Its IUPAC name is N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]benzamide.
| Compound Name | N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 25167581 |
| Molecular Formula | C26H27F3N6O4 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | N-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1)c1ccccc1 |
| InChI | InChI=1S/C26H27F3N6O4/c27-26(28,29)39-22-9-5-4-8-19(22)15-31-25-32-16-21(35(37)38)23(34-25)30-14-17-10-12-20(13-11-17)33-24(36)18-6-2-1-3-7-18/h1-9,16-17,20H,10-15H2,(H,33,36)(H2,30,31,32,34) |
| InChIKey | MWJQYTNFPIRXAV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|