C29H32F3N7O4 — CID 25168376
N-[1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-yl]benzamide (PubChem CID 25168376) has the molecular formula C29H32F3N7O4 and a molecular weight of 599.61 g/mol. Its IUPAC name is N-[1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-yl]benzamide.
| Compound Name | N-[1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-yl]benzamide |
|---|---|
| PubChem CID | 25168376 |
| Molecular Formula | C29H32F3N7O4 |
| Molecular Weight | 599.61 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | N-[1-[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]azetidin-3-yl]benzamide |
| SMILES | O=C(NC1CN(C2CCC(CNc3nc(NCc4ccccc4OC(F)(F)F)ncc3[N+](=O)[O-])CC2)C1)c1ccccc1 |
| InChI | InChI=1S/C29H32F3N7O4/c30-29(31,32)43-25-9-5-4-8-21(25)15-34-28-35-16-24(39(41)42)26(37-28)33-14-19-10-12-23(13-11-19)38-17-22(18-38)36-27(40)20-6-2-1-3-7-20/h1-9,16,19,22-23H,10-15,17-18H2,(H,36,40)(H2,33,34,35,37) |
| InChIKey | BWQJGEULISTUAM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|