C26H29N7OS — CID 25169120
4-[(2-amino-1,3-benzothiazol-6-yl)amino]-6-methyl-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile (PubChem CID 25169120) has the molecular formula C26H29N7OS and a molecular weight of 487.63 g/mol. Its IUPAC name is 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-6-methyl-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile.
| Compound Name | 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-6-methyl-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 25169120 |
| Molecular Formula | C26H29N7OS |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 4-[(2-amino-1,3-benzothiazol-6-yl)amino]-6-methyl-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline-3-carbonitrile |
| SMILES | Cc1cc2c(Nc3ccc4nc(N)sc4c3)c(C#N)cnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C26H29N7OS/c1-17-12-20-22(14-23(17)34-11-3-6-33-9-7-32(2)8-10-33)29-16-18(15-27)25(20)30-19-4-5-21-24(13-19)35-26(28)31-21/h4-5,12-14,16H,3,6-11H2,1-2H3,(H2,28,31)(H,29,30) |
| InChIKey | HMGYAOFKBQVVQM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|