C22H29FN6O2 — CID 25169974
6-amino-2-butoxy-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one (PubChem CID 25169974) has the molecular formula C22H29FN6O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 6-amino-2-butoxy-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one.
| Compound Name | 6-amino-2-butoxy-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one |
|---|---|
| PubChem CID | 25169974 |
| Molecular Formula | C22H29FN6O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 6-amino-2-butoxy-9-[[3-[(4-fluoropiperidin-1-yl)methyl]phenyl]methyl]-7H-purin-8-one |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)n(Cc3cccc(CN4CCC(F)CC4)c3)c2n1 |
| InChI | InChI=1S/C22H29FN6O2/c1-2-3-11-31-21-26-19(24)18-20(27-21)29(22(30)25-18)14-16-6-4-5-15(12-16)13-28-9-7-17(23)8-10-28/h4-6,12,17H,2-3,7-11,13-14H2,1H3,(H,25,30)(H2,24,26,27) |
| InChIKey | QOSRNDXDMBSKEO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|